C17H23N3O2 — CID 109079061
4-N-cycloheptyl-2-N-prop-2-enylpyridine-2,4-dicarboxamide (PubChem CID 109079061) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-N-cycloheptyl-2-N-prop-2-enylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-cycloheptyl-2-N-prop-2-enylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079061 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 4-N-cycloheptyl-2-N-prop-2-enylpyridine-2,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1cc(C(=O)NC2CCCCCC2)ccn1 |
| InChI | InChI=1S/C17H23N3O2/c1-2-10-19-17(22)15-12-13(9-11-18-15)16(21)20-14-7-5-3-4-6-8-14/h2,9,11-12,14H,1,3-8,10H2,(H,19,22)(H,20,21) |
| InChIKey | XAWOTQQUSHNLBS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|