C23H29N3O2 — CID 109089061
4-N-cycloheptyl-2-N-(3-phenylpropyl)pyridine-2,4-dicarboxamide (PubChem CID 109089061) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-N-cycloheptyl-2-N-(3-phenylpropyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-cycloheptyl-2-N-(3-phenylpropyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109089061 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-N-cycloheptyl-2-N-(3-phenylpropyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(NC1CCCCCC1)c1ccnc(C(=O)NCCCc2ccccc2)c1 |
| InChI | InChI=1S/C23H29N3O2/c27-22(26-20-12-6-1-2-7-13-20)19-14-16-24-21(17-19)23(28)25-15-8-11-18-9-4-3-5-10-18/h3-5,9-10,14,16-17,20H,1-2,6-8,11-13,15H2,(H,25,28)(H,26,27) |
| InChIKey | HOZKUQGTUZEWSZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|