C22H22N4O2 — CID 109087124
2-N-(3-phenylpropyl)-4-N-(pyridin-2-ylmethyl)pyridine-2,4-dicarboxamide (PubChem CID 109087124) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-N-(3-phenylpropyl)-4-N-(pyridin-2-ylmethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(3-phenylpropyl)-4-N-(pyridin-2-ylmethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109087124 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-N-(3-phenylpropyl)-4-N-(pyridin-2-ylmethyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(NCc1ccccn1)c1ccnc(C(=O)NCCCc2ccccc2)c1 |
| InChI | InChI=1S/C22H22N4O2/c27-21(26-16-19-10-4-5-12-23-19)18-11-14-24-20(15-18)22(28)25-13-6-9-17-7-2-1-3-8-17/h1-5,7-8,10-12,14-15H,6,9,13,16H2,(H,25,28)(H,26,27) |
| InChIKey | JZWPWTOMPZNSKY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|