C16H23N3O2 — CID 109079185
4-N-butyl-2-N-cyclopentylpyridine-2,4-dicarboxamide (PubChem CID 109079185) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-N-butyl-2-N-cyclopentylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-butyl-2-N-cyclopentylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079185 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-N-butyl-2-N-cyclopentylpyridine-2,4-dicarboxamide |
| SMILES | CCCCNC(=O)c1ccnc(C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-3-9-18-15(20)12-8-10-17-14(11-12)16(21)19-13-6-4-5-7-13/h8,10-11,13H,2-7,9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | SLEXVAGWIWQYGK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|