C20H30N4O4 — CID 109088657
ethyl 4-[[2-(pentylcarbamoyl)pyridine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109088657) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is ethyl 4-[[2-(pentylcarbamoyl)pyridine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(pentylcarbamoyl)pyridine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109088657 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | ethyl 4-[[2-(pentylcarbamoyl)pyridine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCCCCNC(=O)c1cc(C(=O)NC2CCN(C(=O)OCC)CC2)ccn1 |
| InChI | InChI=1S/C20H30N4O4/c1-3-5-6-10-22-19(26)17-14-15(7-11-21-17)18(25)23-16-8-12-24(13-9-16)20(27)28-4-2/h7,11,14,16H,3-6,8-10,12-13H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | BHORFRAYUBIMDZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|