C19H26N4O5 — CID 109082996
ethyl 4-[[2-(morpholine-4-carbonyl)pyridine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109082996) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl 4-[[2-(morpholine-4-carbonyl)pyridine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(morpholine-4-carbonyl)pyridine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109082996 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | ethyl 4-[[2-(morpholine-4-carbonyl)pyridine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccnc(C(=O)N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C19H26N4O5/c1-2-28-19(26)23-7-4-15(5-8-23)21-17(24)14-3-6-20-16(13-14)18(25)22-9-11-27-12-10-22/h3,6,13,15H,2,4-5,7-12H2,1H3,(H,21,24) |
| InChIKey | VCZGCCUVRVEYLW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |