C22H28N4O3 — CID 109174202
ethyl 4-[[2-(4-ethylanilino)pyridine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109174202) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl 4-[[2-(4-ethylanilino)pyridine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(4-ethylanilino)pyridine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109174202 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | ethyl 4-[[2-(4-ethylanilino)pyridine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccnc(Nc3ccc(CC)cc3)c2)CC1 |
| InChI | InChI=1S/C22H28N4O3/c1-3-16-5-7-18(8-6-16)24-20-15-17(9-12-23-20)21(27)25-19-10-13-26(14-11-19)22(28)29-4-2/h5-9,12,15,19H,3-4,10-11,13-14H2,1-2H3,(H,23,24)(H,25,27) |
| InChIKey | WKHHYNDTDCMJDN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |