C18H26N4O4 — CID 109079428
ethyl 4-[2-(butylcarbamoyl)pyridine-4-carbonyl]piperazine-1-carboxylate (PubChem CID 109079428) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl 4-[2-(butylcarbamoyl)pyridine-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(butylcarbamoyl)pyridine-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109079428 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | ethyl 4-[2-(butylcarbamoyl)pyridine-4-carbonyl]piperazine-1-carboxylate |
| SMILES | CCCCNC(=O)c1cc(C(=O)N2CCN(C(=O)OCC)CC2)ccn1 |
| InChI | InChI=1S/C18H26N4O4/c1-3-5-7-20-16(23)15-13-14(6-8-19-15)17(24)21-9-11-22(12-10-21)18(25)26-4-2/h6,8,13H,3-5,7,9-12H2,1-2H3,(H,20,23) |
| InChIKey | BLPOZRFQKMUBCD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|