C14H21N3O3 — CID 109079379
2-N-butyl-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide (PubChem CID 109079379) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-N-butyl-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-butyl-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079379 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-N-butyl-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide |
| SMILES | CCCCNC(=O)c1cc(C(=O)NCCOC)ccn1 |
| InChI | InChI=1S/C14H21N3O3/c1-3-4-6-16-14(19)12-10-11(5-7-15-12)13(18)17-8-9-20-2/h5,7,10H,3-4,6,8-9H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | KCAWKVPWCZSOAS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|