C13H17N3O3 — CID 109078607
2-N-cyclopropyl-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide (PubChem CID 109078607) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-N-cyclopropyl-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-cyclopropyl-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109078607 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-N-cyclopropyl-4-N-(2-methoxyethyl)pyridine-2,4-dicarboxamide |
| SMILES | COCCNC(=O)c1ccnc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C13H17N3O3/c1-19-7-6-15-12(17)9-4-5-14-11(8-9)13(18)16-10-2-3-10/h4-5,8,10H,2-3,6-7H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | MFKIOLLXQVOQJT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|