C15H23N3O3 — CID 109079380
2-N-butyl-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide (PubChem CID 109079380) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-N-butyl-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-butyl-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079380 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-N-butyl-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
| SMILES | CCCCNC(=O)c1cc(C(=O)NCCCOC)ccn1 |
| InChI | InChI=1S/C15H23N3O3/c1-3-4-7-18-15(20)13-11-12(6-9-16-13)14(19)17-8-5-10-21-2/h6,9,11H,3-5,7-8,10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | HOXUCUONVHWQQY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|