C17H26N4O4 — CID 109082488
4-N-(3-methoxypropyl)-2-N-(2-morpholin-4-ylethyl)pyridine-2,4-dicarboxamide (PubChem CID 109082488) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-N-(3-methoxypropyl)-2-N-(2-morpholin-4-ylethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(3-methoxypropyl)-2-N-(2-morpholin-4-ylethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082488 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-N-(3-methoxypropyl)-2-N-(2-morpholin-4-ylethyl)pyridine-2,4-dicarboxamide |
| SMILES | COCCCNC(=O)c1ccnc(C(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C17H26N4O4/c1-24-10-2-4-19-16(22)14-3-5-18-15(13-14)17(23)20-6-7-21-8-11-25-12-9-21/h3,5,13H,2,4,6-12H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | GWBHKIOYMDYXAS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|