C19H23N3O4 — CID 109082506
2-N-[(4-methoxyphenyl)methyl]-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide (PubChem CID 109082506) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-N-[(4-methoxyphenyl)methyl]-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[(4-methoxyphenyl)methyl]-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109082506 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-N-[(4-methoxyphenyl)methyl]-4-N-(3-methoxypropyl)pyridine-2,4-dicarboxamide |
| SMILES | COCCCNC(=O)c1ccnc(C(=O)NCc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-25-11-3-9-21-18(23)15-8-10-20-17(12-15)19(24)22-13-14-4-6-16(26-2)7-5-14/h4-8,10,12H,3,9,11,13H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | NPYSWFIFFWJZLX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|