C17H27N5O3 — CID 109352795
ethyl 4-[6-(pentylcarbamoyl)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 109352795) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is ethyl 4-[6-(pentylcarbamoyl)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(pentylcarbamoyl)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109352795 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | ethyl 4-[6-(pentylcarbamoyl)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCCCCNC(=O)c1cc(N2CCN(C(=O)OCC)CC2)ncn1 |
| InChI | InChI=1S/C17H27N5O3/c1-3-5-6-7-18-16(23)14-12-15(20-13-19-14)21-8-10-22(11-9-21)17(24)25-4-2/h12-13H,3-11H2,1-2H3,(H,18,23) |
| InChIKey | OCOYQULXVITFLO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|