C17H26N6O3 — CID 109345115
ethyl 4-[6-(4-methylpiperazine-1-carbonyl)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 109345115) has the molecular formula C17H26N6O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl 4-[6-(4-methylpiperazine-1-carbonyl)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(4-methylpiperazine-1-carbonyl)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109345115 |
| Molecular Formula | C17H26N6O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | ethyl 4-[6-(4-methylpiperazine-1-carbonyl)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(C(=O)N3CCN(C)CC3)ncn2)CC1 |
| InChI | InChI=1S/C17H26N6O3/c1-3-26-17(25)23-10-8-21(9-11-23)15-12-14(18-13-19-15)16(24)22-6-4-20(2)5-7-22/h12-13H,3-11H2,1-2H3 |
| InChIKey | JHAMGXXDXOITEY-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 82.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |