C15H25N5O2 — CID 112855122
ethyl 4-[6-(butylamino)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 112855122) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is ethyl 4-[6-(butylamino)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(butylamino)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112855122 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | ethyl 4-[6-(butylamino)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCCCNc1cc(N2CCN(C(=O)OCC)CC2)ncn1 |
| InChI | InChI=1S/C15H25N5O2/c1-3-5-6-16-13-11-14(18-12-17-13)19-7-9-20(10-8-19)15(21)22-4-2/h11-12H,3-10H2,1-2H3,(H,16,17,18) |
| InChIKey | GUWQQSFLXDLEME-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|