C14H24N6O2 — CID 112940126
ethyl 4-[3-(butylamino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate (PubChem CID 112940126) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is ethyl 4-[3-(butylamino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(butylamino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112940126 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | ethyl 4-[3-(butylamino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate |
| SMILES | CCCCNc1nncc(N2CCN(C(=O)OCC)CC2)n1 |
| InChI | InChI=1S/C14H24N6O2/c1-3-5-6-15-13-17-12(11-16-18-13)19-7-9-20(10-8-19)14(21)22-4-2/h11H,3-10H2,1-2H3,(H,15,17,18) |
| InChIKey | RBDXILNHZRNKTQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|