C17H19N7O2 — CID 112957087
ethyl 4-[3-(4-cyanoanilino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate (PubChem CID 112957087) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is ethyl 4-[3-(4-cyanoanilino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(4-cyanoanilino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112957087 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | ethyl 4-[3-(4-cyanoanilino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cnnc(Nc3ccc(C#N)cc3)n2)CC1 |
| InChI | InChI=1S/C17H19N7O2/c1-2-26-17(25)24-9-7-23(8-10-24)15-12-19-22-16(21-15)20-14-5-3-13(11-18)4-6-14/h3-6,12H,2,7-10H2,1H3,(H,20,21,22) |
| InChIKey | SLWDJQCJOKMBBJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |