C20H27N5O3 — CID 112923322
ethyl 4-[2-(4-ethoxyanilino)-6-methylpyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 112923322) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is ethyl 4-[2-(4-ethoxyanilino)-6-methylpyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(4-ethoxyanilino)-6-methylpyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112923322 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | ethyl 4-[2-(4-ethoxyanilino)-6-methylpyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(C)nc(Nc3ccc(OCC)cc3)n2)CC1 |
| InChI | InChI=1S/C20H27N5O3/c1-4-27-17-8-6-16(7-9-17)22-19-21-15(3)14-18(23-19)24-10-12-25(13-11-24)20(26)28-5-2/h6-9,14H,4-5,10-13H2,1-3H3,(H,21,22,23) |
| InChIKey | ZXMZLLKNYRPXRH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |