C21H29N5O2 — CID 122624197
tert-butyl 4-[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 122624197) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is tert-butyl 4-[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122624197 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | tert-butyl 4-[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(Nc2nc(C)cc(N3CCN(C(=O)OC(C)(C)C)CC3)n2)cc1 |
| InChI | InChI=1S/C21H29N5O2/c1-15-6-8-17(9-7-15)23-19-22-16(2)14-18(24-19)25-10-12-26(13-11-25)20(27)28-21(3,4)5/h6-9,14H,10-13H2,1-5H3,(H,22,23,24) |
| InChIKey | BISXMZVFJLXYEH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |