C18H24N6O2 — CID 112957025
ethyl 4-[3-(2-ethylanilino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate (PubChem CID 112957025) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is ethyl 4-[3-(2-ethylanilino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(2-ethylanilino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112957025 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | ethyl 4-[3-(2-ethylanilino)-1,2,4-triazin-5-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cnnc(Nc3ccccc3CC)n2)CC1 |
| InChI | InChI=1S/C18H24N6O2/c1-3-14-7-5-6-8-15(14)20-17-21-16(13-19-22-17)23-9-11-24(12-10-23)18(25)26-4-2/h5-8,13H,3-4,9-12H2,1-2H3,(H,20,21,22) |
| InChIKey | XOSYEAFBUGXOFA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |