C21H24N6 — CID 112955465
N-(2-ethylphenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112955465) has the molecular formula C21H24N6 and a molecular weight of 360.47 g/mol. Its IUPAC name is N-(2-ethylphenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-(2-ethylphenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112955465 |
| Molecular Formula | C21H24N6 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | N-(2-ethylphenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | CCc1ccccc1Nc1nncc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C21H24N6/c1-2-17-8-6-7-11-19(17)23-21-24-20(16-22-25-21)27-14-12-26(13-15-27)18-9-4-3-5-10-18/h3-11,16H,2,12-15H2,1H3,(H,23,24,25) |
| InChIKey | OLMMFUALVGWANY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |