C19H18F2N6 — CID 112955512
N-(2,4-difluorophenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112955512) has the molecular formula C19H18F2N6 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-(2,4-difluorophenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112955512 |
| Molecular Formula | C19H18F2N6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | Fc1ccc(Nc2nncc(N3CCN(c4ccccc4)CC3)n2)c(F)c1 |
| InChI | InChI=1S/C19H18F2N6/c20-14-6-7-17(16(21)12-14)23-19-24-18(13-22-25-19)27-10-8-26(9-11-27)15-4-2-1-3-5-15/h1-7,12-13H,8-11H2,(H,23,24,25) |
| InChIKey | RHAMKWLTQZGERO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |