C19H18F2N6 — CID 112968928
5-N-(2,4-difluorophenyl)-3-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112968928) has the molecular formula C19H18F2N6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 5-N-(2,4-difluorophenyl)-3-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(2,4-difluorophenyl)-3-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112968928 |
| Molecular Formula | C19H18F2N6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 5-N-(2,4-difluorophenyl)-3-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Fc1ccc(Nc2cnnc(Nc3ccc(N4CCCC4)cc3)n2)c(F)c1 |
| InChI | InChI=1S/C19H18F2N6/c20-13-3-8-17(16(21)11-13)24-18-12-22-26-19(25-18)23-14-4-6-15(7-5-14)27-9-1-2-10-27/h3-8,11-12H,1-2,9-10H2,(H2,23,24,25,26) |
| InChIKey | XABSETAHHSMBHN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|