C21H21F2N5 — CID 112878913
4-N-(2,4-difluorophenyl)-2-methyl-6-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine (PubChem CID 112878913) has the molecular formula C21H21F2N5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-N-(2,4-difluorophenyl)-2-methyl-6-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,4-difluorophenyl)-2-methyl-6-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112878913 |
| Molecular Formula | C21H21F2N5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-N-(2,4-difluorophenyl)-2-methyl-6-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine |
| SMILES | Cc1nc(Nc2ccc(N3CCCC3)cc2)cc(Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C21H21F2N5/c1-14-24-20(13-21(25-14)27-19-9-4-15(22)12-18(19)23)26-16-5-7-17(8-6-16)28-10-2-3-11-28/h4-9,12-13H,2-3,10-11H2,1H3,(H2,24,25,26,27) |
| InChIKey | PYKLNWVKXNYPFJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|