C15H20N6 — CID 80907284
6-hydrazinyl-2-methyl-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-4-amine (PubChem CID 80907284) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 6-hydrazinyl-2-methyl-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-2-methyl-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80907284 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 6-hydrazinyl-2-methyl-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-4-amine |
| SMILES | Cc1nc(NN)cc(Nc2ccc(N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C15H20N6/c1-11-17-14(10-15(18-11)20-16)19-12-4-6-13(7-5-12)21-8-2-3-9-21/h4-7,10H,2-3,8-9,16H2,1H3,(H2,17,18,19,20) |
| InChIKey | XWWFDPVLESGPFE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|