C20H27N5 — CID 112909558
6-methyl-N-(4-piperidin-1-ylphenyl)-2-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 112909558) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 6-methyl-N-(4-piperidin-1-ylphenyl)-2-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | 6-methyl-N-(4-piperidin-1-ylphenyl)-2-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112909558 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 6-methyl-N-(4-piperidin-1-ylphenyl)-2-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccc(N3CCCCC3)cc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C20H27N5/c1-16-15-19(23-20(21-16)25-13-5-6-14-25)22-17-7-9-18(10-8-17)24-11-3-2-4-12-24/h7-10,15H,2-6,11-14H2,1H3,(H,21,22,23) |
| InChIKey | CUNHHZNUMGSYHW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|