C22H33N5 — CID 112926428
6-methyl-4-N-(4-piperidin-1-ylphenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine (PubChem CID 112926428) has the molecular formula C22H33N5 and a molecular weight of 367.54 g/mol. Its IUPAC name is 6-methyl-4-N-(4-piperidin-1-ylphenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-(4-piperidin-1-ylphenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112926428 |
| Molecular Formula | C22H33N5 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 6-methyl-4-N-(4-piperidin-1-ylphenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCN(CCC)c1nc(C)cc(Nc2ccc(N3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C22H33N5/c1-4-13-27(14-5-2)22-23-18(3)17-21(25-22)24-19-9-11-20(12-10-19)26-15-7-6-8-16-26/h9-12,17H,4-8,13-16H2,1-3H3,(H,23,24,25) |
| InChIKey | YZCVKJUIFATJBJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|