C20H31N7 — CID 112960996
5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine (PubChem CID 112960996) has the molecular formula C20H31N7 and a molecular weight of 369.52 g/mol. Its IUPAC name is 5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112960996 |
| Molecular Formula | C20H31N7 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | 5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCN(CCC)c1nncc(Nc2ccc(N3CCN(C)CC3)cc2)n1 |
| InChI | InChI=1S/C20H31N7/c1-4-10-27(11-5-2)20-23-19(16-21-24-20)22-17-6-8-18(9-7-17)26-14-12-25(3)13-15-26/h6-9,16H,4-5,10-15H2,1-3H3,(H,22,23,24) |
| InChIKey | MBYBSODHDJTBER-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|