C18H24N6O — CID 113049844
N-[6-[4-(4-methylpiperazin-1-yl)anilino]pyridazin-3-yl]propanamide (PubChem CID 113049844) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[6-[4-(4-methylpiperazin-1-yl)anilino]pyridazin-3-yl]propanamide.
| Compound Name | N-[6-[4-(4-methylpiperazin-1-yl)anilino]pyridazin-3-yl]propanamide |
|---|---|
| PubChem CID | 113049844 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | N-[6-[4-(4-methylpiperazin-1-yl)anilino]pyridazin-3-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc(Nc2ccc(N3CCN(C)CC3)cc2)nn1 |
| InChI | InChI=1S/C18H24N6O/c1-3-18(25)20-17-9-8-16(21-22-17)19-14-4-6-15(7-5-14)24-12-10-23(2)11-13-24/h4-9H,3,10-13H2,1-2H3,(H,19,21)(H,20,22,25) |
| InChIKey | UQOVXJCTWGXGHG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|