C20H28N6O — CID 109110732
6-(butylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridazine-3-carboxamide (PubChem CID 109110732) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 6-(butylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridazine-3-carboxamide.
| Compound Name | 6-(butylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109110732 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 6-(butylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridazine-3-carboxamide |
| SMILES | CCCCNc1ccc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)nn1 |
| InChI | InChI=1S/C20H28N6O/c1-3-4-11-21-19-10-9-18(23-24-19)20(27)22-16-5-7-17(8-6-16)26-14-12-25(2)13-15-26/h5-10H,3-4,11-15H2,1-2H3,(H,21,24)(H,22,27) |
| InChIKey | DEUWLNDSIHHRRH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|