C22H29N5O2 — CID 109094346
2-N-butyl-6-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2,6-dicarboxamide (PubChem CID 109094346) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-N-butyl-6-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-butyl-6-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109094346 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 2-N-butyl-6-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)c1cccc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)n1 |
| InChI | InChI=1S/C22H29N5O2/c1-3-4-12-23-21(28)19-6-5-7-20(25-19)22(29)24-17-8-10-18(11-9-17)27-15-13-26(2)14-16-27/h5-11H,3-4,12-16H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | IUWYWASFQVXJRF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|