C17H18BrN3O2 — CID 109094351
6-N-(3-bromophenyl)-2-N-butylpyridine-2,6-dicarboxamide (PubChem CID 109094351) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is 6-N-(3-bromophenyl)-2-N-butylpyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3-bromophenyl)-2-N-butylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109094351 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 6-N-(3-bromophenyl)-2-N-butylpyridine-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)c1cccc(C(=O)Nc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C17H18BrN3O2/c1-2-3-10-19-16(22)14-8-5-9-15(21-14)17(23)20-13-7-4-6-12(18)11-13/h4-9,11H,2-3,10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | LDSFIXDJBXLDNV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|