C18H20BrN3O2 — CID 109099598
2-N-(3-bromophenyl)-6-N-butyl-6-N-methylpyridine-2,6-dicarboxamide (PubChem CID 109099598) has the molecular formula C18H20BrN3O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 2-N-(3-bromophenyl)-6-N-butyl-6-N-methylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(3-bromophenyl)-6-N-butyl-6-N-methylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109099598 |
| Molecular Formula | C18H20BrN3O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-N-(3-bromophenyl)-6-N-butyl-6-N-methylpyridine-2,6-dicarboxamide |
| SMILES | CCCCN(C)C(=O)c1cccc(C(=O)Nc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C18H20BrN3O2/c1-3-4-11-22(2)18(24)16-10-6-9-15(21-16)17(23)20-14-8-5-7-13(19)12-14/h5-10,12H,3-4,11H2,1-2H3,(H,20,23) |
| InChIKey | AGIVCUVNBSYXGJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |