C19H23N3O3 — CID 109099571
6-N-butyl-2-N-(3-methoxyphenyl)-6-N-methylpyridine-2,6-dicarboxamide (PubChem CID 109099571) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 6-N-butyl-2-N-(3-methoxyphenyl)-6-N-methylpyridine-2,6-dicarboxamide.
| Compound Name | 6-N-butyl-2-N-(3-methoxyphenyl)-6-N-methylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109099571 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 6-N-butyl-2-N-(3-methoxyphenyl)-6-N-methylpyridine-2,6-dicarboxamide |
| SMILES | CCCCN(C)C(=O)c1cccc(C(=O)Nc2cccc(OC)c2)n1 |
| InChI | InChI=1S/C19H23N3O3/c1-4-5-12-22(2)19(24)17-11-7-10-16(21-17)18(23)20-14-8-6-9-15(13-14)25-3/h6-11,13H,4-5,12H2,1-3H3,(H,20,23) |
| InChIKey | KZDKSLWHMYFGFH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |