C20H17N3O3 — CID 109099989
6-N-(3-methoxyphenyl)-2-N-phenylpyridine-2,6-dicarboxamide (PubChem CID 109099989) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 6-N-(3-methoxyphenyl)-2-N-phenylpyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3-methoxyphenyl)-2-N-phenylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109099989 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 6-N-(3-methoxyphenyl)-2-N-phenylpyridine-2,6-dicarboxamide |
| SMILES | COc1cccc(NC(=O)c2cccc(C(=O)Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H17N3O3/c1-26-16-10-5-9-15(13-16)22-20(25)18-12-6-11-17(23-18)19(24)21-14-7-3-2-4-8-14/h2-13H,1H3,(H,21,24)(H,22,25) |
| InChIKey | ZRVRXKLKHKNWMX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |