C20H15F2N3O3 — CID 109100953
6-N-(3,4-difluorophenyl)-2-N-(3-methoxyphenyl)pyridine-2,6-dicarboxamide (PubChem CID 109100953) has the molecular formula C20H15F2N3O3 and a molecular weight of 383.35 g/mol. Its IUPAC name is 6-N-(3,4-difluorophenyl)-2-N-(3-methoxyphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3,4-difluorophenyl)-2-N-(3-methoxyphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109100953 |
| Molecular Formula | C20H15F2N3O3 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 6-N-(3,4-difluorophenyl)-2-N-(3-methoxyphenyl)pyridine-2,6-dicarboxamide |
| SMILES | COc1cccc(NC(=O)c2cccc(C(=O)Nc3ccc(F)c(F)c3)n2)c1 |
| InChI | InChI=1S/C20H15F2N3O3/c1-28-14-5-2-4-12(10-14)23-19(26)17-6-3-7-18(25-17)20(27)24-13-8-9-15(21)16(22)11-13/h2-11H,1H3,(H,23,26)(H,24,27) |
| InChIKey | KGTRPQPVBMWAOL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |