C22H19F2N3O2 — CID 109100678
6-N-(3,4-difluorophenyl)-2-N-(4-propan-2-ylphenyl)pyridine-2,6-dicarboxamide (PubChem CID 109100678) has the molecular formula C22H19F2N3O2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 6-N-(3,4-difluorophenyl)-2-N-(4-propan-2-ylphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3,4-difluorophenyl)-2-N-(4-propan-2-ylphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109100678 |
| Molecular Formula | C22H19F2N3O2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 6-N-(3,4-difluorophenyl)-2-N-(4-propan-2-ylphenyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)c2cccc(C(=O)Nc3ccc(F)c(F)c3)n2)cc1 |
| InChI | InChI=1S/C22H19F2N3O2/c1-13(2)14-6-8-15(9-7-14)25-21(28)19-4-3-5-20(27-19)22(29)26-16-10-11-17(23)18(24)12-16/h3-13H,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | WFCLCDYQNXXOCS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |