C20H17N3O2 — CID 109099953
6-N-(3-methylphenyl)-2-N-phenylpyridine-2,6-dicarboxamide (PubChem CID 109099953) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 6-N-(3-methylphenyl)-2-N-phenylpyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3-methylphenyl)-2-N-phenylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109099953 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 6-N-(3-methylphenyl)-2-N-phenylpyridine-2,6-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(C(=O)Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H17N3O2/c1-14-7-5-10-16(13-14)22-20(25)18-12-6-11-17(23-18)19(24)21-15-8-3-2-4-9-15/h2-13H,1H3,(H,21,24)(H,22,25) |
| InChIKey | JTANLQVUODIKBW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |