C22H21N3O2 — CID 109100172
6-N-(2,5-dimethylphenyl)-2-N-(4-methylphenyl)pyridine-2,6-dicarboxamide (PubChem CID 109100172) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-N-(2,5-dimethylphenyl)-2-N-(4-methylphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(2,5-dimethylphenyl)-2-N-(4-methylphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109100172 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 6-N-(2,5-dimethylphenyl)-2-N-(4-methylphenyl)pyridine-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(=O)Nc3cc(C)ccc3C)n2)cc1 |
| InChI | InChI=1S/C22H21N3O2/c1-14-8-11-17(12-9-14)23-21(26)18-5-4-6-19(24-18)22(27)25-20-13-15(2)7-10-16(20)3/h4-13H,1-3H3,(H,23,26)(H,25,27) |
| InChIKey | ZSYZMPGQYJCJKZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |