C21H18ClN3O2 — CID 109099984
6-N-(2-chloro-4,6-dimethylphenyl)-2-N-phenylpyridine-2,6-dicarboxamide (PubChem CID 109099984) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 6-N-(2-chloro-4,6-dimethylphenyl)-2-N-phenylpyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(2-chloro-4,6-dimethylphenyl)-2-N-phenylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109099984 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 6-N-(2-chloro-4,6-dimethylphenyl)-2-N-phenylpyridine-2,6-dicarboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cccc(C(=O)Nc3ccccc3)n2)c(Cl)c1 |
| InChI | InChI=1S/C21H18ClN3O2/c1-13-11-14(2)19(16(22)12-13)25-21(27)18-10-6-9-17(24-18)20(26)23-15-7-4-3-5-8-15/h3-12H,1-2H3,(H,23,26)(H,25,27) |
| InChIKey | QTRBUQGIOKPVGW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |