C15H22N2O3 — CID 108952045
N'-butyl-N-(3-methoxyphenyl)-N'-methylpropanediamide (PubChem CID 108952045) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N'-butyl-N-(3-methoxyphenyl)-N'-methylpropanediamide.
| Compound Name | N'-butyl-N-(3-methoxyphenyl)-N'-methylpropanediamide |
|---|---|
| PubChem CID | 108952045 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N'-butyl-N-(3-methoxyphenyl)-N'-methylpropanediamide |
| SMILES | CCCCN(C)C(=O)CC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-4-5-9-17(2)15(19)11-14(18)16-12-7-6-8-13(10-12)20-3/h6-8,10H,4-5,9,11H2,1-3H3,(H,16,18) |
| InChIKey | UULDIERKZBRVAX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|