C9H12N2O3 — CID 12611733
2-(hydroxyamino)-N-(3-methoxyphenyl)acetamide (PubChem CID 12611733) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(hydroxyamino)-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-(hydroxyamino)-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 12611733 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(hydroxyamino)-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CNO)c1 |
| InChI | InChI=1S/C9H12N2O3/c1-14-8-4-2-3-7(5-8)11-9(12)6-10-13/h2-5,10,13H,6H2,1H3,(H,11,12) |
| InChIKey | XIYULKUYXOJCDG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|