About cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate)
cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate) (PubChem CID 6100941) has the molecular formula C18H20CoN2O4S2
and a molecular weight of 451.44 g/mol. Its IUPAC name is cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate).
Molecular Properties
| Compound Name | cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate) |
| PubChem CID | 6100941 |
| Molecular Formula | C18H20CoN2O4S2 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate) |
| SMILES | COc1cccc(NC(=O)C[S-])c1.COc1cccc(NC(=O)C[S-])c1.[Co+2] |
| InChI | InChI=1S/2C9H11NO2S.Co/c2*1-12-8-4-2-3-7(5-8)10-9(11)6-13;/h2*2-5,13H,6H2,1H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | LPSZUXGEXYRHGU-UHFFFAOYSA-L |
| XLogP | 2.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate)?
The IUPAC name of cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate) (CID 6100941) is cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate).
What is the SMILES notation for cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate)?
The canonical SMILES for cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate) is COc1cccc(NC(=O)C[S-])c1.COc1cccc(NC(=O)C[S-])c1.[Co+2].
What is the InChIKey of cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate)?
The InChIKey is LPSZUXGEXYRHGU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H11NO2S.Co/c2*1-12-8-4-2-3-7(5-8)10-9(11)6-13;/h2*2-5,13H,6H2,1H3,(H,10,11);/q;;+2/p-2.
What are the key properties of cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate)?
cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate) has a molecular weight of 451.44 g/mol, XLogP of 2.36, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(2-(3-methoxyanilino)-2-oxoethanethiolate) is sourced from PubChem (CID 6100941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).