C12H17NO3 — CID 79017987
4-hydroxy-N-(3-methoxyphenyl)pentanamide (PubChem CID 79017987) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-hydroxy-N-(3-methoxyphenyl)pentanamide.
| Compound Name | 4-hydroxy-N-(3-methoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 79017987 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-hydroxy-N-(3-methoxyphenyl)pentanamide |
| SMILES | COc1cccc(NC(=O)CCC(C)O)c1 |
| InChI | InChI=1S/C12H17NO3/c1-9(14)6-7-12(15)13-10-4-3-5-11(8-10)16-2/h3-5,8-9,14H,6-7H2,1-2H3,(H,13,15) |
| InChIKey | HJXIFTKPPNFILI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |