C14H21ClN2O4 — CID 119913523
2-[[3-(3-methoxyanilino)-3-oxopropyl]-methylamino]propanoic acid;hydrochloride (PubChem CID 119913523) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-[[3-(3-methoxyanilino)-3-oxopropyl]-methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[[3-(3-methoxyanilino)-3-oxopropyl]-methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913523 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[[3-(3-methoxyanilino)-3-oxopropyl]-methylamino]propanoic acid;hydrochloride |
| SMILES | COc1cccc(NC(=O)CCN(C)C(C)C(=O)O)c1.Cl |
| InChI | InChI=1S/C14H20N2O4.ClH/c1-10(14(18)19)16(2)8-7-13(17)15-11-5-4-6-12(9-11)20-3;/h4-6,9-10H,7-8H2,1-3H3,(H,15,17)(H,18,19);1H |
| InChIKey | BMQDNQKOCJFDQK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |