C17H26N4O4 — CID 8594560
2-[[2-(butylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(3-methoxyphenyl)acetamide (PubChem CID 8594560) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[[2-(butylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(butylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 8594560 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[[2-(butylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(3-methoxyphenyl)acetamide |
| SMILES | CCCCNC(=O)NC(=O)CN(C)CC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C17H26N4O4/c1-4-5-9-18-17(24)20-16(23)12-21(2)11-15(22)19-13-7-6-8-14(10-13)25-3/h6-8,10H,4-5,9,11-12H2,1-3H3,(H,19,22)(H2,18,20,23,24) |
| InChIKey | NLQALFYAUARYJM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|