C19H20F3N3O4 — CID 9366505
2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 9366505) has the molecular formula C19H20F3N3O4 and a molecular weight of 411.38 g/mol. Its IUPAC name is 2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 9366505 |
| Molecular Formula | C19H20F3N3O4 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COc1cccc(NC(=O)CN(C)CC(=O)Nc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H20F3N3O4/c1-25(12-18(27)24-14-4-3-5-16(10-14)28-2)11-17(26)23-13-6-8-15(9-7-13)29-19(20,21)22/h3-10H,11-12H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | WXKSALGTKBGRHL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |