C19H22BrN3O3 — CID 9198492
2-[[2-(3-bromo-4-methylanilino)-2-oxoethyl]-methylamino]-N-(3-methoxyphenyl)acetamide (PubChem CID 9198492) has the molecular formula C19H22BrN3O3 and a molecular weight of 420.31 g/mol. Its IUPAC name is 2-[[2-(3-bromo-4-methylanilino)-2-oxoethyl]-methylamino]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(3-bromo-4-methylanilino)-2-oxoethyl]-methylamino]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9198492 |
| Molecular Formula | C19H22BrN3O3 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-[[2-(3-bromo-4-methylanilino)-2-oxoethyl]-methylamino]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CN(C)CC(=O)Nc2ccc(C)c(Br)c2)c1 |
| InChI | InChI=1S/C19H22BrN3O3/c1-13-7-8-15(10-17(13)20)22-19(25)12-23(2)11-18(24)21-14-5-4-6-16(9-14)26-3/h4-10H,11-12H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | GVHBUVVJJKZUGM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |