C25H26N4O4 — CID 2521413
2-[[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]acetyl]amino]-N-phenylbenzamide (PubChem CID 2521413) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-[[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]acetyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]acetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 2521413 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]acetyl]amino]-N-phenylbenzamide |
| SMILES | COc1cccc(NC(=O)CN(C)CC(=O)Nc2ccccc2C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C25H26N4O4/c1-29(16-23(30)26-19-11-8-12-20(15-19)33-2)17-24(31)28-22-14-7-6-13-21(22)25(32)27-18-9-4-3-5-10-18/h3-15H,16-17H2,1-2H3,(H,26,30)(H,27,32)(H,28,31) |
| InChIKey | UARUOEYSUQPRPI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |